C18H11NO4 — CID 170638986
methyl 6,11-dioxo-5H-benzo[b]carbazole-2-carboxylate (PubChem CID 170638986) has the molecular formula C18H11NO4 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 6,11-dioxo-5H-benzo[b]carbazole-2-carboxylate.
| Compound Name | methyl 6,11-dioxo-5H-benzo[b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 170638986 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 6,11-dioxo-5H-benzo[b]carbazole-2-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C18H11NO4/c1-23-18(22)9-6-7-13-12(8-9)14-15(19-13)17(21)11-5-3-2-4-10(11)16(14)20/h2-8,19H,1H3 |
| InChIKey | GQOCORUEXYJZIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|