C14H9NO4 — CID 14969611
methyl 4,5-dioxo-1H-benzo[g]indole-2-carboxylate (PubChem CID 14969611) has the molecular formula C14H9NO4 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 4,5-dioxo-1H-benzo[g]indole-2-carboxylate.
| Compound Name | methyl 4,5-dioxo-1H-benzo[g]indole-2-carboxylate |
|---|---|
| PubChem CID | 14969611 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | methyl 4,5-dioxo-1H-benzo[g]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)-c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C14H9NO4/c1-19-14(18)10-6-9-11(15-10)7-4-2-3-5-8(7)12(16)13(9)17/h2-6,15H,1H3 |
| InChIKey | ZZOBIVPFJSORGB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|