C23H23NO6 — CID 170638975
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5H-benzo[b]carbazole-6,11-dione (PubChem CID 170638975) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5H-benzo[b]carbazole-6,11-dione.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5H-benzo[b]carbazole-6,11-dione |
|---|---|
| PubChem CID | 170638975 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5H-benzo[b]carbazole-6,11-dione |
| SMILES | COCCOCCOCCOc1ccc2[nH]c3c(c2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C23H23NO6/c1-27-8-9-28-10-11-29-12-13-30-15-6-7-19-18(14-15)20-21(24-19)23(26)17-5-3-2-4-16(17)22(20)25/h2-7,14,24H,8-13H2,1H3 |
| InChIKey | DMOBCQOVJRWQNQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|