C17H9NO4 — CID 10541575
5,7-dioxa-11-azapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),9,14,16,18-heptaene-13,20-dione (PubChem CID 10541575) has the molecular formula C17H9NO4 and a molecular weight of 291.26 g/mol. Its IUPAC name is 5,7-dioxa-11-azapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),9,14,16,18-heptaene-13,20-dione.
| Compound Name | 5,7-dioxa-11-azapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),9,14,16,18-heptaene-13,20-dione |
|---|---|
| PubChem CID | 10541575 |
| Molecular Formula | C17H9NO4 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 5,7-dioxa-11-azapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),9,14,16,18-heptaene-13,20-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1[nH]c1cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H9NO4/c19-16-8-3-1-2-4-9(8)17(20)15-14(16)10-5-12-13(22-7-21-12)6-11(10)18-15/h1-6,18H,7H2 |
| InChIKey | PCXISZRYMULEOV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|