C10H7NO4 — CID 54726414
8-hydroxy-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 54726414) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 8-hydroxy-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 8-hydroxy-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 54726414 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 8-hydroxy-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1cc(O)c2cc3c(cc2[nH]1)OCO3 |
| InChI | InChI=1S/C10H7NO4/c12-7-3-10(13)11-6-2-9-8(1-5(6)7)14-4-15-9/h1-3H,4H2,(H2,11,12,13) |
| InChIKey | NEDKEOGANUFWAA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |