C17H7N3O6 — CID 11494023
5,7-dioxa-11,15,20-triazahexacyclo[10.10.0.02,10.04,8.013,17.018,22]docosa-1(22),2,4(8),9,12,17-hexaene-14,16,19,21-tetrone (PubChem CID 11494023) has the molecular formula C17H7N3O6 and a molecular weight of 349.26 g/mol. Its IUPAC name is 5,7-dioxa-11,15,20-triazahexacyclo[10.10.0.02,10.04,8.013,17.018,22]docosa-1(22),2,4(8),9,12,17-hexaene-14,16,19,21-tetrone.
| Compound Name | 5,7-dioxa-11,15,20-triazahexacyclo[10.10.0.02,10.04,8.013,17.018,22]docosa-1(22),2,4(8),9,12,17-hexaene-14,16,19,21-tetrone |
|---|---|
| PubChem CID | 11494023 |
| Molecular Formula | C17H7N3O6 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 5,7-dioxa-11,15,20-triazahexacyclo[10.10.0.02,10.04,8.013,17.018,22]docosa-1(22),2,4(8),9,12,17-hexaene-14,16,19,21-tetrone |
| SMILES | O=c1[nH]c(=O)c2c1c1[nH]c3cc4c(cc3c1c1c(=O)[nH]c(=O)c21)OCO4 |
| InChI | InChI=1S/C17H7N3O6/c21-14-9-8-4-1-6-7(26-3-25-6)2-5(4)18-13(8)12-11(10(9)15(22)19-14)16(23)20-17(12)24/h1-2,18H,3H2,(H,19,21,22)(H,20,23,24) |
| InChIKey | LQNUPSCQTNQHMA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |