C19H11NO5 — CID 101151005
5,7,17,19-tetraoxa-12-azahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-11-one (PubChem CID 101151005) has the molecular formula C19H11NO5 and a molecular weight of 333.30 g/mol. Its IUPAC name is 5,7,17,19-tetraoxa-12-azahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-11-one.
| Compound Name | 5,7,17,19-tetraoxa-12-azahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-11-one |
|---|---|
| PubChem CID | 101151005 |
| Molecular Formula | C19H11NO5 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 5,7,17,19-tetraoxa-12-azahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-11-one |
| SMILES | O=c1[nH]c2c3cc4c(cc3ccc2c2cc3c(cc12)OCO3)OCO4 |
| InChI | InChI=1S/C19H11NO5/c21-19-13-6-17-16(24-8-25-17)5-12(13)10-2-1-9-3-14-15(23-7-22-14)4-11(9)18(10)20-19/h1-6H,7-8H2,(H,20,21) |
| InChIKey | ZGNWMOUMGZCFJQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|