C19H12O5 — CID 135196704
18-methoxy-5,7,14-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15(20),16,18-octaen-21-one (PubChem CID 135196704) has the molecular formula C19H12O5 and a molecular weight of 320.30 g/mol. Its IUPAC name is 18-methoxy-5,7,14-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15(20),16,18-octaen-21-one.
| Compound Name | 18-methoxy-5,7,14-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15(20),16,18-octaen-21-one |
|---|---|
| PubChem CID | 135196704 |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 18-methoxy-5,7,14-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15(20),16,18-octaen-21-one |
| SMILES | COc1ccc2oc3ccc4cc5c(cc4c3c(=O)c2c1)OCO5 |
| InChI | InChI=1S/C19H12O5/c1-21-11-3-5-14-13(7-11)19(20)18-12-8-17-16(22-9-23-17)6-10(12)2-4-15(18)24-14/h2-8H,9H2,1H3 |
| InChIKey | KNAFHVAUFKILAB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|