C20H14O7 — CID 99996095
(8S)-8-(6-methoxy-4-oxochromen-3-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 99996095) has the molecular formula C20H14O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is (8S)-8-(6-methoxy-4-oxochromen-3-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | (8S)-8-(6-methoxy-4-oxochromen-3-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 99996095 |
| Molecular Formula | C20H14O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (8S)-8-(6-methoxy-4-oxochromen-3-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | COc1ccc2occ([C@H]3CC(=O)Oc4cc5c(cc43)OCO5)c(=O)c2c1 |
| InChI | InChI=1S/C20H14O7/c1-23-10-2-3-15-13(4-10)20(22)14(8-24-15)11-6-19(21)27-16-7-18-17(5-12(11)16)25-9-26-18/h2-5,7-8,11H,6,9H2,1H3/t11-/m0/s1 |
| InChIKey | NCONZLUSDUKMMI-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|