C20H15NO6 — CID 99986944
7-methoxy-3-[(8R)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]-1H-quinolin-2-one (PubChem CID 99986944) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is 7-methoxy-3-[(8R)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]-1H-quinolin-2-one.
| Compound Name | 7-methoxy-3-[(8R)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 99986944 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 7-methoxy-3-[(8R)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]-1H-quinolin-2-one |
| SMILES | COc1ccc2cc([C@@H]3CC(=O)Oc4cc5c(cc43)OCO5)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H15NO6/c1-24-11-3-2-10-4-14(20(23)21-15(10)5-11)12-7-19(22)27-16-8-18-17(6-13(12)16)25-9-26-18/h2-6,8,12H,7,9H2,1H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | JCDIBPXGLQOHID-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|