C24H21NO6 — CID 91636711
10-(6-methoxy-2-oxo-1H-quinolin-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione (PubChem CID 91636711) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is 10-(6-methoxy-2-oxo-1H-quinolin-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 10-(6-methoxy-2-oxo-1H-quinolin-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 91636711 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 10-(6-methoxy-2-oxo-1H-quinolin-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1ccc2[nH]c(=O)c(C3CC(=O)Oc4ccc5c(c43)OC(C)(C)CC5=O)cc2c1 |
| InChI | InChI=1S/C24H21NO6/c1-24(2)11-18(26)14-5-7-19-21(22(14)31-24)15(10-20(27)30-19)16-9-12-8-13(29-3)4-6-17(12)25-23(16)28/h4-9,15H,10-11H2,1-3H3,(H,25,28) |
| InChIKey | KSIIEYSAGXUPMQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|