C28H19NO6 — CID 163091631
2-[(2-methoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163091631) has the molecular formula C28H19NO6 and a molecular weight of 465.46 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-[(2-methoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163091631 |
| Molecular Formula | C28H19NO6 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[(2-methoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccccc1C=C1Oc2c(ccc3c2C(c2cc4ccccc4[nH]c2=O)CC(=O)O3)C1=O |
| InChI | InChI=1S/C28H19NO6/c1-33-21-9-5-3-7-16(21)13-23-26(31)17-10-11-22-25(27(17)35-23)18(14-24(30)34-22)19-12-15-6-2-4-8-20(15)29-28(19)32/h2-13,18H,14H2,1H3,(H,29,32) |
| InChIKey | BBQXKYBYDNBVFM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|