C30H23NO8 — CID 125122705
(2Z,9R)-9-(2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125122705) has the molecular formula C30H23NO8 and a molecular weight of 525.51 g/mol. Its IUPAC name is (2Z,9R)-9-(2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125122705 |
| Molecular Formula | C30H23NO8 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (2Z,9R)-9-(2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2c(ccc3c2[C@H](c2cc4ccccc4[nH]c2=O)CC(=O)O3)C1=O |
| InChI | InChI=1S/C30H23NO8/c1-35-22-14-24(37-3)23(36-2)11-16(22)12-25-28(33)17-8-9-21-27(29(17)39-25)18(13-26(32)38-21)19-10-15-6-4-5-7-20(15)31-30(19)34/h4-12,14,18H,13H2,1-3H3,(H,31,34)/b25-12-/t18-/m0/s1 |
| InChIKey | NROFMQUZHKLTQP-OCBWPWIBSA-N |
| XLogP | 4.61 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|