C34H31NO8 — CID 125429463
(2Z,9S)-9-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125429463) has the molecular formula C34H31NO8 and a molecular weight of 581.62 g/mol. Its IUPAC name is (2Z,9S)-9-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125429463 |
| Molecular Formula | C34H31NO8 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | (2Z,9S)-9-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2c(ccc3c2[C@@H](c2cc4ccccc4n(CC(C)C)c2=O)CC(=O)O3)C1=O |
| InChI | InChI=1S/C34H31NO8/c1-18(2)17-35-24-9-7-6-8-19(24)12-23(34(35)38)22-15-30(36)42-25-11-10-21-32(37)29(43-33(21)31(22)25)14-20-13-27(40-4)28(41-5)16-26(20)39-3/h6-14,16,18,22H,15,17H2,1-5H3/b29-14-/t22-/m1/s1 |
| InChIKey | ZKARTISLXUCXII-WGJSBGIVSA-N |
| XLogP | 5.74 |
| TPSA | 102.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|