C29H23NO6 — CID 124879128
(2Z,9R)-9-(2,4-dimethoxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879128) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is (2Z,9R)-9-(2,4-dimethoxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(2,4-dimethoxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879128 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (2Z,9R)-9-(2,4-dimethoxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc([C@H]2CC(=O)Oc3ccc4c(c32)O/C(=C\c2cn(C)c3ccccc23)C4=O)c(OC)c1 |
| InChI | InChI=1S/C29H23NO6/c1-30-15-16(18-6-4-5-7-22(18)30)12-25-28(32)20-10-11-23-27(29(20)36-25)21(14-26(31)35-23)19-9-8-17(33-2)13-24(19)34-3/h4-13,15,21H,14H2,1-3H3/b25-12-/t21-/m1/s1 |
| InChIKey | PUZMUQIEKZWYPF-NJCFKQHQSA-N |
| XLogP | 5.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|