C27H19NO5 — CID 163077928
9-(3-hydroxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163077928) has the molecular formula C27H19NO5 and a molecular weight of 437.45 g/mol. Its IUPAC name is 9-(3-hydroxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-(3-hydroxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163077928 |
| Molecular Formula | C27H19NO5 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 9-(3-hydroxyphenyl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | Cn1cc(C=C2Oc3c(ccc4c3C(c3cccc(O)c3)CC(=O)O4)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H19NO5/c1-28-14-16(18-7-2-3-8-21(18)28)12-23-26(31)19-9-10-22-25(27(19)33-23)20(13-24(30)32-22)15-5-4-6-17(29)11-15/h2-12,14,20,29H,13H2,1H3 |
| InChIKey | LRUYTPRURBPTSD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|