C34H26N2O6 — CID 125122831
(2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-9-[2-(pyridin-2-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125122831) has the molecular formula C34H26N2O6 and a molecular weight of 558.59 g/mol. Its IUPAC name is (2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-9-[2-(pyridin-2-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-9-[2-(pyridin-2-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125122831 |
| Molecular Formula | C34H26N2O6 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | (2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-9-[2-(pyridin-2-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3c(ccc4c3[C@H](c3ccccc3OCc3ccccn3)CC(=O)O4)C1=O)cn2C |
| InChI | InChI=1S/C34H26N2O6/c1-36-18-20(25-16-22(39-2)10-12-27(25)36)15-30-33(38)24-11-13-29-32(34(24)42-30)26(17-31(37)41-29)23-8-3-4-9-28(23)40-19-21-7-5-6-14-35-21/h3-16,18,26H,17,19H2,1-2H3/b30-15-/t26-/m0/s1 |
| InChIKey | QKRCWOKKOFFQPJ-GRXZTXSZSA-N |
| XLogP | 6.22 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|