C27H21BrO7 — CID 124879973
(2Z,9R)-9-(2-bromophenyl)-2-[(2,3,4-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879973) has the molecular formula C27H21BrO7 and a molecular weight of 537.36 g/mol. Its IUPAC name is (2Z,9R)-9-(2-bromophenyl)-2-[(2,3,4-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(2-bromophenyl)-2-[(2,3,4-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879973 |
| Molecular Formula | C27H21BrO7 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | (2Z,9R)-9-(2-bromophenyl)-2-[(2,3,4-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3[C@H](c3ccccc3Br)CC(=O)O4)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C27H21BrO7/c1-31-20-10-8-14(25(32-2)27(20)33-3)12-21-24(30)16-9-11-19-23(26(16)35-21)17(13-22(29)34-19)15-6-4-5-7-18(15)28/h4-12,17H,13H2,1-3H3/b21-12-/t17-/m0/s1 |
| InChIKey | XYLSEYPXBVCITO-WCEBZYJUSA-N |
| XLogP | 5.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|