C22H14O7 — CID 99992460
(4R)-4-(6-methoxy-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 99992460) has the molecular formula C22H14O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is (4R)-4-(6-methoxy-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | (4R)-4-(6-methoxy-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 99992460 |
| Molecular Formula | C22H14O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (4R)-4-(6-methoxy-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | COc1ccc2occ([C@H]3CC(=O)Oc4c3c(=O)oc3ccccc43)c(=O)c2c1 |
| InChI | InChI=1S/C22H14O7/c1-26-11-6-7-16-14(8-11)20(24)15(10-27-16)13-9-18(23)29-21-12-4-2-3-5-17(12)28-22(25)19(13)21/h2-8,10,13H,9H2,1H3/t13-/m1/s1 |
| InChIKey | CMSFYFODJAORRP-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|