C21H11ClO6 — CID 99989931
(4R)-4-(6-chloro-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 99989931) has the molecular formula C21H11ClO6 and a molecular weight of 394.77 g/mol. Its IUPAC name is (4R)-4-(6-chloro-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | (4R)-4-(6-chloro-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 99989931 |
| Molecular Formula | C21H11ClO6 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | (4R)-4-(6-chloro-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | O=C1C[C@H](c2coc3ccc(Cl)cc3c2=O)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C21H11ClO6/c22-10-5-6-15-13(7-10)19(24)14(9-26-15)12-8-17(23)28-20-11-3-1-2-4-16(11)27-21(25)18(12)20/h1-7,9,12H,8H2/t12-/m1/s1 |
| InChIKey | OMHFBERJFRMHML-GFCCVEGCSA-N |
| XLogP | 3.99 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|