C18H11NO6 — CID 7348630
(4S)-4-(4-nitrophenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 7348630) has the molecular formula C18H11NO6 and a molecular weight of 337.29 g/mol. Its IUPAC name is (4S)-4-(4-nitrophenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | (4S)-4-(4-nitrophenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 7348630 |
| Molecular Formula | C18H11NO6 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (4S)-4-(4-nitrophenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | O=C1C[C@@H](c2ccc([N+](=O)[O-])cc2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C18H11NO6/c20-15-9-13(10-5-7-11(8-6-10)19(22)23)16-17(25-15)12-3-1-2-4-14(12)24-18(16)21/h1-8,13H,9H2/t13-/m0/s1 |
| InChIKey | ANJWTFFVFRHVBA-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|