C23H13N3O6 — CID 1286423
(4S)-2-amino-4-[5-(4-nitrophenyl)furan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 1286423) has the molecular formula C23H13N3O6 and a molecular weight of 427.37 g/mol. Its IUPAC name is (4S)-2-amino-4-[5-(4-nitrophenyl)furan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-[5-(4-nitrophenyl)furan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1286423 |
| Molecular Formula | C23H13N3O6 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (4S)-2-amino-4-[5-(4-nitrophenyl)furan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)[C@H]1c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C23H13N3O6/c24-11-15-19(18-10-9-16(30-18)12-5-7-13(8-6-12)26(28)29)20-21(32-22(15)25)14-3-1-2-4-17(14)31-23(20)27/h1-10,19H,25H2/t19-/m1/s1 |
| InChIKey | ZWPBQOIMHMGXCP-LJQANCHMSA-N |
| XLogP | 4.18 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|