C20H14N2O6 — CID 101372648
3-acetyl-2-amino-4-(4-nitrophenyl)-4H-pyrano[3,2-c]chromen-5-one (PubChem CID 101372648) has the molecular formula C20H14N2O6 and a molecular weight of 378.34 g/mol. Its IUPAC name is 3-acetyl-2-amino-4-(4-nitrophenyl)-4H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 3-acetyl-2-amino-4-(4-nitrophenyl)-4H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 101372648 |
| Molecular Formula | C20H14N2O6 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-acetyl-2-amino-4-(4-nitrophenyl)-4H-pyrano[3,2-c]chromen-5-one |
| SMILES | CC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N2O6/c1-10(23)15-16(11-6-8-12(9-7-11)22(25)26)17-18(28-19(15)21)13-4-2-3-5-14(13)27-20(17)24/h2-9,16H,21H2,1H3 |
| InChIKey | OJANAGDUXYKHJQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|