C20H15NO8 — CID 46914997
methyl (4R)-2-hydroxy-4-(4-nitrophenyl)-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate (PubChem CID 46914997) has the molecular formula C20H15NO8 and a molecular weight of 397.34 g/mol. Its IUPAC name is methyl (4R)-2-hydroxy-4-(4-nitrophenyl)-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl (4R)-2-hydroxy-4-(4-nitrophenyl)-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 46914997 |
| Molecular Formula | C20H15NO8 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl (4R)-2-hydroxy-4-(4-nitrophenyl)-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)C1(O)C[C@H](c2ccc([N+](=O)[O-])cc2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C20H15NO8/c1-27-19(23)20(24)10-14(11-6-8-12(9-7-11)21(25)26)16-17(29-20)13-4-2-3-5-15(13)28-18(16)22/h2-9,14,24H,10H2,1H3/t14-,20?/m1/s1 |
| InChIKey | RJKLAFINNCBZTJ-QMRFKDRMSA-N |
| XLogP | 2.48 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|