C20H18O5 — CID 71498651
2-hydroxy-4-(2-methoxyphenyl)-2-methyl-3,4-dihydropyrano[3,2-c]chromen-5-one (PubChem CID 71498651) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-hydroxy-4-(2-methoxyphenyl)-2-methyl-3,4-dihydropyrano[3,2-c]chromen-5-one.
| Compound Name | 2-hydroxy-4-(2-methoxyphenyl)-2-methyl-3,4-dihydropyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 71498651 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-hydroxy-4-(2-methoxyphenyl)-2-methyl-3,4-dihydropyrano[3,2-c]chromen-5-one |
| SMILES | COc1ccccc1C1CC(C)(O)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C20H18O5/c1-20(22)11-14(12-7-3-5-9-15(12)23-2)17-18(25-20)13-8-4-6-10-16(13)24-19(17)21/h3-10,14,22H,11H2,1-2H3 |
| InChIKey | VLVCVYWMCGLGJI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|