C28H22O5 — CID 102492856
13-[4-(2-methylprop-2-enoxy)phenyl]-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15,17,19-heptaen-3-one (PubChem CID 102492856) has the molecular formula C28H22O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 13-[4-(2-methylprop-2-enoxy)phenyl]-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15,17,19-heptaen-3-one.
| Compound Name | 13-[4-(2-methylprop-2-enoxy)phenyl]-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15,17,19-heptaen-3-one |
|---|---|
| PubChem CID | 102492856 |
| Molecular Formula | C28H22O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 13-[4-(2-methylprop-2-enoxy)phenyl]-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15,17,19-heptaen-3-one |
| SMILES | C=C(C)COc1ccc(C23CC(c4ccccc4O2)c2c(c4ccccc4oc2=O)O3)cc1 |
| InChI | InChI=1S/C28H22O5/c1-17(2)16-30-19-13-11-18(12-14-19)28-15-22(20-7-3-6-10-24(20)32-28)25-26(33-28)21-8-4-5-9-23(21)31-27(25)29/h3-14,22H,1,15-16H2,2H3 |
| InChIKey | NGQURWSQIGBEBJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|