C24H16O6 — CID 12735698
17-hydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15(20),16,18-heptaen-3-one (PubChem CID 12735698) has the molecular formula C24H16O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is 17-hydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15(20),16,18-heptaen-3-one.
| Compound Name | 17-hydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15(20),16,18-heptaen-3-one |
|---|---|
| PubChem CID | 12735698 |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 17-hydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),5,7,9,15(20),16,18-heptaen-3-one |
| SMILES | O=c1oc2ccccc2c2c1C1CC(c3ccc(O)cc3)(Oc3cc(O)ccc31)O2 |
| InChI | InChI=1S/C24H16O6/c25-14-7-5-13(6-8-14)24-12-18(16-10-9-15(26)11-20(16)29-24)21-22(30-24)17-3-1-2-4-19(17)28-23(21)27/h1-11,18,25-26H,12H2 |
| InChIKey | OWGWIOAZISMZMK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|