C20H10N2O6 — CID 171344888
22-hydroxy-4,12,18-trioxa-14,16-diazahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),5,7,9,13,17(25),19(24),20,22-nonaene-3,15-dione (PubChem CID 171344888) has the molecular formula C20H10N2O6 and a molecular weight of 374.31 g/mol. Its IUPAC name is 22-hydroxy-4,12,18-trioxa-14,16-diazahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),5,7,9,13,17(25),19(24),20,22-nonaene-3,15-dione.
| Compound Name | 22-hydroxy-4,12,18-trioxa-14,16-diazahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),5,7,9,13,17(25),19(24),20,22-nonaene-3,15-dione |
|---|---|
| PubChem CID | 171344888 |
| Molecular Formula | C20H10N2O6 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 22-hydroxy-4,12,18-trioxa-14,16-diazahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),5,7,9,13,17(25),19(24),20,22-nonaene-3,15-dione |
| SMILES | O=c1nc2c3c([nH]1)Oc1ccc(O)cc1C3c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C20H10N2O6/c23-8-5-6-12-10(7-8)13-14-16(9-3-1-2-4-11(9)27-19(14)24)28-18-15(13)17(26-12)21-20(25)22-18/h1-7,13,23H,(H,21,22,25) |
| InChIKey | NTXUFQPYGCDJSO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|