C25H14O10 — CID 54683163
1,3-dihydroxy-7-(4,5,7-trihydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one (PubChem CID 54683163) has the molecular formula C25H14O10 and a molecular weight of 474.38 g/mol. Its IUPAC name is 1,3-dihydroxy-7-(4,5,7-trihydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one.
| Compound Name | 1,3-dihydroxy-7-(4,5,7-trihydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 54683163 |
| Molecular Formula | C25H14O10 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1,3-dihydroxy-7-(4,5,7-trihydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(O)c2c(O)c1C1c2ccccc2Oc2c1c(=O)oc1cc(O)cc(O)c21 |
| InChI | InChI=1S/C25H14O10/c26-9-5-12(28)18-15(7-9)34-24(31)20(22(18)30)17-11-3-1-2-4-14(11)33-23-19-13(29)6-10(27)8-16(19)35-25(32)21(17)23/h1-8,17,26-30H |
| InChIKey | WDWTVZCHCZWFGF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 170.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|