C25H20O6 — CID 54732039
3-(8,10-dimethoxy-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-hydroxychromen-2-one (PubChem CID 54732039) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-(8,10-dimethoxy-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-hydroxychromen-2-one.
| Compound Name | 3-(8,10-dimethoxy-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54732039 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-(8,10-dimethoxy-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-hydroxychromen-2-one |
| SMILES | COc1cc2c(c(OC)c1)C(c1c(O)c3ccccc3oc1=O)c1ccccc1OC2 |
| InChI | InChI=1S/C25H20O6/c1-28-15-11-14-13-30-18-9-5-3-7-16(18)22(21(14)20(12-15)29-2)23-24(26)17-8-4-6-10-19(17)31-25(23)27/h3-12,22,26H,13H2,1-2H3 |
| InChIKey | COHWATJQNXJKQE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|