C20H19NO5 — CID 54725413
3-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-hydroxychromen-2-one (PubChem CID 54725413) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54725413 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-hydroxychromen-2-one |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1c(O)c3ccccc3oc1=O)NCC2 |
| InChI | InChI=1S/C20H19NO5/c1-24-15-9-11-7-8-21-18(13(11)10-16(15)25-2)17-19(22)12-5-3-4-6-14(12)26-20(17)23/h3-6,9-10,18,21-22H,7-8H2,1-2H3/t18-/m0/s1 |
| InChIKey | BHPGCCLRUVHOCZ-SFHVURJKSA-N |
| XLogP | 2.75 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|