C23H25N3O5 — CID 5131004
5-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 5131004) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5131004 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1cc2c(cc1OC)C(c1c(O)n(-c3ccc(C)c(C)c3)c(=O)[nH]c1=O)NCC2 |
| InChI | InChI=1S/C23H25N3O5/c1-12-5-6-15(9-13(12)2)26-22(28)19(21(27)25-23(26)29)20-16-11-18(31-4)17(30-3)10-14(16)7-8-24-20/h5-6,9-11,20,24,28H,7-8H2,1-4H3,(H,25,27,29) |
| InChIKey | ATBNPBPGIVDTON-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |