C22H24N3O5+ — CID 7068271
5-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 7068271) has the molecular formula C22H24N3O5+ and a molecular weight of 410.45 g/mol. Its IUPAC name is 5-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068271 |
| Molecular Formula | C22H24N3O5+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1c(O)n(-c3ccc(C)cc3)c(=O)[nH]c1=O)[NH2+]CC2 |
| InChI | InChI=1S/C22H23N3O5/c1-12-4-6-14(7-5-12)25-21(27)18(20(26)24-22(25)28)19-15-11-17(30-3)16(29-2)10-13(15)8-9-23-19/h4-7,10-11,19,23,27H,8-9H2,1-3H3,(H,24,26,28)/p+1/t19-/m0/s1 |
| InChIKey | FTTUHUXYQCEQCM-IBGZPJMESA-O |
| XLogP | 0.77 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |