C17H20NO2+ — CID 6921357
(1R)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 6921357) has the molecular formula C17H20NO2+ and a molecular weight of 270.35 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (1R)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 6921357 |
| Molecular Formula | C17H20NO2+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1R)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccccc1)[NH2+]CC2 |
| InChI | InChI=1S/C17H19NO2/c1-19-15-10-13-8-9-18-17(12-6-4-3-5-7-12)14(13)11-16(15)20-2/h3-7,10-11,17-18H,8-9H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | GZGZWZVAJDFXJK-QGZVFWFLSA-O |
| XLogP | 1.91 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |