C24H25NO2 — CID 25389894
(1S)-2-benzyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 25389894) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (1S)-2-benzyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-2-benzyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 25389894 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (1S)-2-benzyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccccc1)N(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H25NO2/c1-26-22-15-20-13-14-25(17-18-9-5-3-6-10-18)24(19-11-7-4-8-12-19)21(20)16-23(22)27-2/h3-12,15-16,24H,13-14,17H2,1-2H3/t24-/m0/s1 |
| InChIKey | DTMDQGQIAKLKNM-DEOSSOPVSA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |