C25H33NO4 — CID 22662976
8-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)octanoic acid (PubChem CID 22662976) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 8-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)octanoic acid.
| Compound Name | 8-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)octanoic acid |
|---|---|
| PubChem CID | 22662976 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 8-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)octanoic acid |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(CCCCCCCC(=O)O)CC2 |
| InChI | InChI=1S/C25H33NO4/c1-29-22-17-20-14-16-26(15-10-5-3-4-9-13-24(27)28)25(19-11-7-6-8-12-19)21(20)18-23(22)30-2/h6-8,11-12,17-18,25H,3-5,9-10,13-16H2,1-2H3,(H,27,28) |
| InChIKey | DDYNKVBEBPTHFP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|