C29H35N3O4 — CID 91928559
6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2-(nitrosomethyl)pyridin-3-ol (PubChem CID 91928559) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2-(nitrosomethyl)pyridin-3-ol.
| Compound Name | 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2-(nitrosomethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 91928559 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2-(nitrosomethyl)pyridin-3-ol |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(CCCCCCc1ccc(O)c(CN=O)n1)CC2 |
| InChI | InChI=1S/C29H35N3O4/c1-35-27-18-22-15-17-32(29(21-10-6-5-7-11-21)24(22)19-28(27)36-2)16-9-4-3-8-12-23-13-14-26(33)25(31-23)20-30-34/h5-7,10-11,13-14,18-19,29,33H,3-4,8-9,12,15-17,20H2,1-2H3 |
| InChIKey | XTGYTRCSFNVVTF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|