C24H29NO2 — CID 11428474
(1S)-2-hept-6-ynyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 11428474) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (1S)-2-hept-6-ynyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-2-hept-6-ynyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11428474 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (1S)-2-hept-6-ynyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C#CCCCCCN1CCc2cc(OC)c(OC)cc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-4-5-6-7-11-15-25-16-14-20-17-22(26-2)23(27-3)18-21(20)24(25)19-12-9-8-10-13-19/h1,8-10,12-13,17-18,24H,5-7,11,14-16H2,2-3H3/t24-/m0/s1 |
| InChIKey | MVGRGFZCGKHWCO-DEOSSOPVSA-N |
| XLogP | 4.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|