C37H38N2O5 — CID 71538521
methyl 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-ynyl]-3-phenylmethoxypyridine-2-carboxylate (PubChem CID 71538521) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is methyl 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-ynyl]-3-phenylmethoxypyridine-2-carboxylate.
| Compound Name | methyl 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-ynyl]-3-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 71538521 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | methyl 6-[6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-ynyl]-3-phenylmethoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C#CCCCCN2CCc3cc(OC)c(OC)cc3C2c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H38N2O5/c1-41-33-24-29-21-23-39(36(28-16-10-7-11-17-28)31(29)25-34(33)42-2)22-13-5-4-12-18-30-19-20-32(35(38-30)37(40)43-3)44-26-27-14-8-6-9-15-27/h6-11,14-17,19-20,24-25,36H,4-5,13,21-23,26H2,1-3H3 |
| InChIKey | RDVMUAAGOBDNHM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|