C19H21NO2 — CID 119135408
4-(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)butanoic acid (PubChem CID 119135408) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)butanoic acid.
| Compound Name | 4-(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 119135408 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)butanoic acid |
| SMILES | O=C(O)CCCN1CCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c21-18(22)11-6-13-20-14-12-15-7-4-5-10-17(15)19(20)16-8-2-1-3-9-16/h1-5,7-10,19H,6,11-14H2,(H,21,22) |
| InChIKey | OIGVZYKARRLVSE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |