About 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid
1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 143893500) has the molecular formula C27H34N2O6
and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| PubChem CID | 143893500 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | C1CN2CCC1CC2.O=C(O)CCC(=O)O.O=C(O)N1CCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C16H15NO2.C7H13N.C4H6O4/c18-16(19)17-11-10-12-6-4-5-9-14(12)15(17)13-7-2-1-3-8-13;1-4-8-5-2-7(1)3-6-8;5-3(6)1-2-4(7)8/h1-9,15H,10-11H2,(H,18,19);7H,1-6H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | YWRBMLUXOWAROE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The IUPAC name of 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (CID 143893500) is 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid is C1CN2CCC1CC2.O=C(O)CCC(=O)O.O=C(O)N1CCc2ccccc2C1c1ccccc1.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The InChIKey is YWRBMLUXOWAROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2.C7H13N.C4H6O4/c18-16(19)17-11-10-12-6-4-5-9-14(12)15(17)13-7-2-1-3-8-13;1-4-8-5-2-7(1)3-6-8;5-3(6)1-2-4(7)8/h1-9,15H,10-11H2,(H,18,19);7H,1-6H2;1-2H2,(H,5,6)(H,7,8).
What are the key properties of 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid has a molecular weight of 482.58 g/mol, XLogP of 4.35, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;butanedioic acid;1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid is sourced from PubChem (CID 143893500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).