C17H20ClN2O2+ — CID 6934570
5-chloro-2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]aniline (PubChem CID 6934570) has the molecular formula C17H20ClN2O2+ and a molecular weight of 319.81 g/mol. Its IUPAC name is 5-chloro-2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]aniline.
| Compound Name | 5-chloro-2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]aniline |
|---|---|
| PubChem CID | 6934570 |
| Molecular Formula | C17H20ClN2O2+ |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-chloro-2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]aniline |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccc(Cl)cc1N)[NH2+]CC2 |
| InChI | InChI=1S/C17H19ClN2O2/c1-21-15-7-10-5-6-20-17(13(10)9-16(15)22-2)12-4-3-11(18)8-14(12)19/h3-4,7-9,17,20H,5-6,19H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | VUADPOYIHKDPEK-QGZVFWFLSA-O |
| XLogP | 2.15 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|