C24H24N4O6 — CID 4868667
6-hydroxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-dione (PubChem CID 4868667) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 6-hydroxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4868667 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 6-hydroxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-dione |
| SMILES | COc1cc(-n2c(O)c(C3NCCc4c3[nH]c3ccccc43)c(=O)[nH]c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H24N4O6/c1-32-16-10-12(11-17(33-2)21(16)34-3)28-23(30)18(22(29)27-24(28)31)20-19-14(8-9-25-20)13-6-4-5-7-15(13)26-19/h4-7,10-11,20,25-26,30H,8-9H2,1-3H3,(H,27,29,31) |
| InChIKey | IVCKKVDJILCRNG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|