C23H22N4O2S — CID 1427783
1-(4-ethylphenyl)-6-hydroxy-2-sulfanylidene-5-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidin-4-one (PubChem CID 1427783) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-6-hydroxy-2-sulfanylidene-5-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidin-4-one.
| Compound Name | 1-(4-ethylphenyl)-6-hydroxy-2-sulfanylidene-5-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 1427783 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-(4-ethylphenyl)-6-hydroxy-2-sulfanylidene-5-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidin-4-one |
| SMILES | CCc1ccc(-n2c(O)c([C@@H]3NCCc4c3[nH]c3ccccc43)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C23H22N4O2S/c1-2-13-7-9-14(10-8-13)27-22(29)18(21(28)26-23(27)30)20-19-16(11-12-24-20)15-5-3-4-6-17(15)25-19/h3-10,20,24-25,29H,2,11-12H2,1H3,(H,26,28,30)/t20-/m0/s1 |
| InChIKey | GRDDMNKQOOGSHM-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|