C23H21ClN4O2S — CID 29098390
5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1-(2-phenylethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 29098390) has the molecular formula C23H21ClN4O2S and a molecular weight of 452.97 g/mol. Its IUPAC name is 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1-(2-phenylethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1-(2-phenylethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 29098390 |
| Molecular Formula | C23H21ClN4O2S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1-(2-phenylethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(CCc2ccccc2)c(O)c1[C@@H]1NCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C23H21ClN4O2S/c24-14-6-7-17-16(12-14)15-8-10-25-20(19(15)26-17)18-21(29)27-23(31)28(22(18)30)11-9-13-4-2-1-3-5-13/h1-7,12,20,25-26,30H,8-11H2,(H,27,29,31)/t20-/m0/s1 |
| InChIKey | WNTHAXFSFVQARQ-FQEVSTJZSA-N |
| XLogP | 4.22 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|