C16H15ClN4O2S — CID 29098395
5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 29098395) has the molecular formula C16H15ClN4O2S and a molecular weight of 362.84 g/mol. Its IUPAC name is 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 29098395 |
| Molecular Formula | C16H15ClN4O2S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1nc(O)c([C@@H]2NCCc3c2[nH]c2ccc(Cl)cc32)c(=O)[nH]1 |
| InChI | InChI=1S/C16H15ClN4O2S/c1-24-16-20-14(22)11(15(23)21-16)13-12-8(4-5-18-13)9-6-7(17)2-3-10(9)19-12/h2-3,6,13,18-19H,4-5H2,1H3,(H2,20,21,22,23)/t13-/m0/s1 |
| InChIKey | LNZRZJJPIWOBLJ-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|