C17H15ClN2O2 — CID 92727171
4-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzene-1,2-diol (PubChem CID 92727171) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzene-1,2-diol.
| Compound Name | 4-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 92727171 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzene-1,2-diol |
| SMILES | Oc1ccc([C@@H]2NCCc3c2[nH]c2ccc(Cl)cc32)cc1O |
| InChI | InChI=1S/C17H15ClN2O2/c18-10-2-3-13-12(8-10)11-5-6-19-16(17(11)20-13)9-1-4-14(21)15(22)7-9/h1-4,7-8,16,19-22H,5-6H2/t16-/m0/s1 |
| InChIKey | MKMIYFNXTRAQHZ-INIZCTEOSA-N |
| XLogP | 3.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|