C15H13ClN4O3 — CID 29146845
5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 29146845) has the molecular formula C15H13ClN4O3 and a molecular weight of 332.75 g/mol. Its IUPAC name is 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 29146845 |
| Molecular Formula | C15H13ClN4O3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c([C@@H]2NCCc3c2[nH]c2ccc(Cl)cc32)c(=O)[nH]1 |
| InChI | InChI=1S/C15H13ClN4O3/c16-6-1-2-9-8(5-6)7-3-4-17-12(11(7)18-9)10-13(21)19-15(23)20-14(10)22/h1-2,5,12,17-18H,3-4H2,(H3,19,20,21,22,23)/t12-/m0/s1 |
| InChIKey | IEIZHXLAKLAQFM-LBPRGKRZSA-N |
| XLogP | 1.14 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|