C17H16Cl2N2O — CID 162645384
4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol;hydrochloride (PubChem CID 162645384) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol;hydrochloride.
| Compound Name | 4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol;hydrochloride |
|---|---|
| PubChem CID | 162645384 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(C2NCCc3c2[nH]c2ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H15ClN2O.ClH/c18-11-3-6-15-14(9-11)13-7-8-19-16(17(13)20-15)10-1-4-12(21)5-2-10;/h1-6,9,16,19-21H,7-8H2;1H |
| InChIKey | ZOZXHFMUDIUESR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|