C21H24ClN3O2 — CID 143312652
1-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 143312652) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 143312652 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)COc1ccc(C2NCCc3c2[nH]c2ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-23-11-15(26)12-27-16-5-2-13(3-6-16)20-21-17(8-9-24-20)18-10-14(22)4-7-19(18)25-21/h2-7,10,15,20,23-26H,8-9,11-12H2,1H3 |
| InChIKey | JTTZCSOGCXUVSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|